C13H13NO4 — CID 134908802
ethyl 4-benzyl-5-oxo-2H-1,2-oxazole-3-carboxylate (PubChem CID 134908802) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 4-benzyl-5-oxo-2H-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 4-benzyl-5-oxo-2H-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 134908802 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | ethyl 4-benzyl-5-oxo-2H-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1[nH]oc(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C13H13NO4/c1-2-17-13(16)11-10(12(15)18-14-11)8-9-6-4-3-5-7-9/h3-7,14H,2,8H2,1H3 |
| InChIKey | BSNYGKNCPXDKNC-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |