C11H9NO4 — CID 105473498
4-benzyl-3-oxo-1,2-oxazole-5-carboxylic acid (PubChem CID 105473498) has the molecular formula C11H9NO4 and a molecular weight of 219.20 g/mol. Its IUPAC name is 4-benzyl-3-oxo-1,2-oxazole-5-carboxylic acid.
| Compound Name | 4-benzyl-3-oxo-1,2-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 105473498 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 4-benzyl-3-oxo-1,2-oxazole-5-carboxylic acid |
| SMILES | O=C(O)c1o[nH]c(=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C11H9NO4/c13-10-8(9(11(14)15)16-12-10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,12,13)(H,14,15) |
| InChIKey | BWGZOYJYIIMOPP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |