C11H11NO2 — CID 13454114
4-ethyl-5-phenyl-1,2-oxazol-3-one (PubChem CID 13454114) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 4-ethyl-5-phenyl-1,2-oxazol-3-one.
| Compound Name | 4-ethyl-5-phenyl-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 13454114 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 4-ethyl-5-phenyl-1,2-oxazol-3-one |
| SMILES | CCc1c(-c2ccccc2)o[nH]c1=O |
| InChI | InChI=1S/C11H11NO2/c1-2-9-10(14-12-11(9)13)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,12,13) |
| InChIKey | WUTUVZHGXKVTDE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |