C27H27O4S+ — CID 164747702
[4-(cyclohexanecarbonyloxy)phenyl]-(3-methoxycarbonylphenyl)-phenylsulfanium (PubChem CID 164747702) has the molecular formula C27H27O4S+ and a molecular weight of 447.58 g/mol. Its IUPAC name is [4-(cyclohexanecarbonyloxy)phenyl]-(3-methoxycarbonylphenyl)-phenylsulfanium.
| Compound Name | [4-(cyclohexanecarbonyloxy)phenyl]-(3-methoxycarbonylphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 164747702 |
| Molecular Formula | C27H27O4S+ |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [4-(cyclohexanecarbonyloxy)phenyl]-(3-methoxycarbonylphenyl)-phenylsulfanium |
| SMILES | COC(=O)c1cccc([S+](c2ccccc2)c2ccc(OC(=O)C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C27H27O4S/c1-30-26(28)21-11-8-14-25(19-21)32(23-12-6-3-7-13-23)24-17-15-22(16-18-24)31-27(29)20-9-4-2-5-10-20/h3,6-8,11-20H,2,4-5,9-10H2,1H3/q+1 |
| InChIKey | PAJKAWHXBKVCCN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|