C10H11NaO4S — CID 23690904
sodium 2-(2-methylprop-2-enoxy)benzenesulfonate (PubChem CID 23690904) has the molecular formula C10H11NaO4S and a molecular weight of 250.25 g/mol. Its IUPAC name is sodium 2-(2-methylprop-2-enoxy)benzenesulfonate.
| Compound Name | sodium 2-(2-methylprop-2-enoxy)benzenesulfonate |
|---|---|
| PubChem CID | 23690904 |
| Molecular Formula | C10H11NaO4S |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | sodium 2-(2-methylprop-2-enoxy)benzenesulfonate |
| SMILES | C=C(C)COc1ccccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C10H12O4S.Na/c1-8(2)7-14-9-5-3-4-6-10(9)15(11,12)13;/h3-6H,1,7H2,2H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | LGXBUKNXWDWEGR-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|