About 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium
2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium (PubChem CID 142670795) has the molecular formula C19H33NO5S
and a molecular weight of 387.54 g/mol. Its IUPAC name is 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium.
Molecular Properties
| Compound Name | 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium |
| PubChem CID | 142670795 |
| Molecular Formula | C19H33NO5S |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium |
| SMILES | CC(=O)Oc1ccccc1S(=O)(=O)[O-].CCCCCCCCC[NH+](C)C |
| InChI | InChI=1S/C11H25N.C8H8O5S/c1-4-5-6-7-8-9-10-11-12(2)3;1-6(9)13-7-4-2-3-5-8(7)14(10,11)12/h4-11H2,1-3H3;2-5H,1H3,(H,10,11,12) |
| InChIKey | ZXNMGEWBTHYQHX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium?
The IUPAC name of 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium (CID 142670795) is 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium.
What is the SMILES notation for 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium?
The canonical SMILES for 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium is CC(=O)Oc1ccccc1S(=O)(=O)[O-].CCCCCCCCC[NH+](C)C.
What is the InChIKey of 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium?
The InChIKey is ZXNMGEWBTHYQHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N.C8H8O5S/c1-4-5-6-7-8-9-10-11-12(2)3;1-6(9)13-7-4-2-3-5-8(7)14(10,11)12/h4-11H2,1-3H3;2-5H,1H3,(H,10,11,12).
What are the key properties of 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium?
2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium has a molecular weight of 387.54 g/mol, XLogP of 2.40, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxybenzenesulfonate;dimethyl(nonyl)azanium is sourced from PubChem (CID 142670795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).