C19H16F6O6S2-2 — CID 71431241
2-[2,2,3,3,4,4-hexafluoro-5-(5-methyl-2-sulfonatophenyl)pentyl]-4-methylbenzenesulfonate (PubChem CID 71431241) has the molecular formula C19H16F6O6S2-2 and a molecular weight of 518.45 g/mol. Its IUPAC name is 2-[2,2,3,3,4,4-hexafluoro-5-(5-methyl-2-sulfonatophenyl)pentyl]-4-methylbenzenesulfonate.
| Compound Name | 2-[2,2,3,3,4,4-hexafluoro-5-(5-methyl-2-sulfonatophenyl)pentyl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71431241 |
| Molecular Formula | C19H16F6O6S2-2 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | 2-[2,2,3,3,4,4-hexafluoro-5-(5-methyl-2-sulfonatophenyl)pentyl]-4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])c(CC(F)(F)C(F)(F)C(F)(F)Cc2cc(C)ccc2S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C19H18F6O6S2/c1-11-3-5-15(32(26,27)28)13(7-11)9-17(20,21)19(24,25)18(22,23)10-14-8-12(2)4-6-16(14)33(29,30)31/h3-8H,9-10H2,1-2H3,(H,26,27,28)(H,29,30,31)/p-2 |
| InChIKey | NUQDMSWLMWGMGB-UHFFFAOYSA-L |
| XLogP | 3.80 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|