C10H12ClO3S- — CID 42609040
2-(3-chloropropyl)-5-methylbenzenesulfonate (PubChem CID 42609040) has the molecular formula C10H12ClO3S- and a molecular weight of 247.72 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-methylbenzenesulfonate.
| Compound Name | 2-(3-chloropropyl)-5-methylbenzenesulfonate |
|---|---|
| PubChem CID | 42609040 |
| Molecular Formula | C10H12ClO3S- |
| Molecular Weight | 247.72 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2-(3-chloropropyl)-5-methylbenzenesulfonate |
| SMILES | Cc1ccc(CCCCl)c(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C10H13ClO3S/c1-8-4-5-9(3-2-6-11)10(7-8)15(12,13)14/h4-5,7H,2-3,6H2,1H3,(H,12,13,14)/p-1 |
| InChIKey | YCNPGSGQHBBOAC-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.72 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|