C14H22ClNO2S — CID 114008809
N-(6-chlorohexyl)-2,5-dimethylbenzenesulfonamide (PubChem CID 114008809) has the molecular formula C14H22ClNO2S and a molecular weight of 303.85 g/mol. Its IUPAC name is N-(6-chlorohexyl)-2,5-dimethylbenzenesulfonamide.
| Compound Name | N-(6-chlorohexyl)-2,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 114008809 |
| Molecular Formula | C14H22ClNO2S |
| Molecular Weight | 303.85 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-(6-chlorohexyl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCCCCCCl)c1 |
| InChI | InChI=1S/C14H22ClNO2S/c1-12-7-8-13(2)14(11-12)19(17,18)16-10-6-4-3-5-9-15/h7-8,11,16H,3-6,9-10H2,1-2H3 |
| InChIKey | GFDXUZVCLOWVDX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|