C11H12F3O4S- — CID 159761716
4-methyl-2-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]benzenesulfonate (PubChem CID 159761716) has the molecular formula C11H12F3O4S- and a molecular weight of 297.27 g/mol. Its IUPAC name is 4-methyl-2-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]benzenesulfonate.
| Compound Name | 4-methyl-2-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]benzenesulfonate |
|---|---|
| PubChem CID | 159761716 |
| Molecular Formula | C11H12F3O4S- |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 4-methyl-2-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]benzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])c(CC[C@@H](O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3O4S/c1-7-2-4-9(19(16,17)18)8(6-7)3-5-10(15)11(12,13)14/h2,4,6,10,15H,3,5H2,1H3,(H,16,17,18)/p-1/t10-/m1/s1 |
| InChIKey | NEZAJVQOBCLQTA-SNVBAGLBSA-M |
| XLogP | 1.75 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|