C22H18F3NO3 — CID 141354573
5-[(E)-2-[4-[[2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]phenyl]ethenyl]benzene-1,3-diol (PubChem CID 141354573) has the molecular formula C22H18F3NO3 and a molecular weight of 401.38 g/mol. Its IUPAC name is 5-[(E)-2-[4-[[2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]phenyl]ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-[4-[[2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]phenyl]ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 141354573 |
| Molecular Formula | C22H18F3NO3 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 5-[(E)-2-[4-[[2-hydroxy-5-(trifluoromethyl)phenyl]methylamino]phenyl]ethenyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(/C=C/c2ccc(NCc3cc(C(F)(F)F)ccc3O)cc2)c1 |
| InChI | InChI=1S/C22H18F3NO3/c23-22(24,25)17-5-8-21(29)16(11-17)13-26-18-6-3-14(4-7-18)1-2-15-9-19(27)12-20(28)10-15/h1-12,26-29H,13H2/b2-1+ |
| InChIKey | DMODTKRLCZGEMH-OWOJBTEDSA-N |
| XLogP | 5.60 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|