C20H18N2O3 — CID 141354574
6-[[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]anilino]methyl]-1H-pyridin-2-one (PubChem CID 141354574) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-[[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]anilino]methyl]-1H-pyridin-2-one.
| Compound Name | 6-[[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]anilino]methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 141354574 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 6-[[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]anilino]methyl]-1H-pyridin-2-one |
| SMILES | O=c1cccc(CNc2ccc(/C=C/c3cc(O)cc(O)c3)cc2)[nH]1 |
| InChI | InChI=1S/C20H18N2O3/c23-18-10-15(11-19(24)12-18)5-4-14-6-8-16(9-7-14)21-13-17-2-1-3-20(25)22-17/h1-12,21,23-24H,13H2,(H,22,25)/b5-4+ |
| InChIKey | LZQBZJPBWKUVJV-SNAWJCMRSA-N |
| XLogP | 3.57 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|