C16H18BrNO3 — CID 60680640
N-[2-(4-bromophenoxy)ethyl]-2,4-dimethoxyaniline (PubChem CID 60680640) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is N-[2-(4-bromophenoxy)ethyl]-2,4-dimethoxyaniline.
| Compound Name | N-[2-(4-bromophenoxy)ethyl]-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 60680640 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-[2-(4-bromophenoxy)ethyl]-2,4-dimethoxyaniline |
| SMILES | COc1ccc(NCCOc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C16H18BrNO3/c1-19-14-7-8-15(16(11-14)20-2)18-9-10-21-13-5-3-12(17)4-6-13/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | IZBGAVAKUSPLDI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|