C16H18Cl2N2O — CID 54808244
N-(3-chloro-4-methoxyphenyl)-N'-(5-chloro-2-methylphenyl)ethane-1,2-diamine (PubChem CID 54808244) has the molecular formula C16H18Cl2N2O and a molecular weight of 325.24 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N'-(5-chloro-2-methylphenyl)ethane-1,2-diamine.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N'-(5-chloro-2-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54808244 |
| Molecular Formula | C16H18Cl2N2O |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N'-(5-chloro-2-methylphenyl)ethane-1,2-diamine |
| SMILES | COc1ccc(NCCNc2cc(Cl)ccc2C)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O/c1-11-3-4-12(17)9-15(11)20-8-7-19-13-5-6-16(21-2)14(18)10-13/h3-6,9-10,19-20H,7-8H2,1-2H3 |
| InChIKey | QVTKYWUVJICEPQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|