C14H23N3 — CID 106709426
6-[(2,5-dimethylpyrrol-1-yl)amino]-2,2-dimethylhexanenitrile (PubChem CID 106709426) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 6-[(2,5-dimethylpyrrol-1-yl)amino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[(2,5-dimethylpyrrol-1-yl)amino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709426 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 6-[(2,5-dimethylpyrrol-1-yl)amino]-2,2-dimethylhexanenitrile |
| SMILES | Cc1ccc(C)n1NCCCCC(C)(C)C#N |
| InChI | InChI=1S/C14H23N3/c1-12-7-8-13(2)17(12)16-10-6-5-9-14(3,4)11-15/h7-8,16H,5-6,9-10H2,1-4H3 |
| InChIKey | ZMDJMTCQXLPWGG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|