C20H27N3OS2 — CID 55397772
1-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-(2-phenylsulfanylethyl)thiourea (PubChem CID 55397772) has the molecular formula C20H27N3OS2 and a molecular weight of 389.59 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-(2-phenylsulfanylethyl)thiourea.
| Compound Name | 1-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-(2-phenylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 55397772 |
| Molecular Formula | C20H27N3OS2 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[2-(dimethylamino)-2-(2-methoxyphenyl)ethyl]-3-(2-phenylsulfanylethyl)thiourea |
| SMILES | COc1ccccc1C(CNC(=S)NCCSc1ccccc1)N(C)C |
| InChI | InChI=1S/C20H27N3OS2/c1-23(2)18(17-11-7-8-12-19(17)24-3)15-22-20(25)21-13-14-26-16-9-5-4-6-10-16/h4-12,18H,13-15H2,1-3H3,(H2,21,22,25) |
| InChIKey | LINVJWAPIIKGAC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|