C17H23N3O4S — CID 4946118
ethyl 4-oxo-4-[[2-(propylcarbamoyl)phenyl]carbamothioylamino]butanoate (PubChem CID 4946118) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is ethyl 4-oxo-4-[[2-(propylcarbamoyl)phenyl]carbamothioylamino]butanoate.
| Compound Name | ethyl 4-oxo-4-[[2-(propylcarbamoyl)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 4946118 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | ethyl 4-oxo-4-[[2-(propylcarbamoyl)phenyl]carbamothioylamino]butanoate |
| SMILES | CCCNC(=O)c1ccccc1NC(=S)NC(=O)CCC(=O)OCC |
| InChI | InChI=1S/C17H23N3O4S/c1-3-11-18-16(23)12-7-5-6-8-13(12)19-17(25)20-14(21)9-10-15(22)24-4-2/h5-8H,3-4,9-11H2,1-2H3,(H,18,23)(H2,19,20,21,25) |
| InChIKey | OWVHCKPWDQBYNB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|