C16H19N3O5S — CID 17351299
ethyl (E)-4-[[2-(2-hydroxyethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobut-2-enoate (PubChem CID 17351299) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is ethyl (E)-4-[[2-(2-hydroxyethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[[2-(2-hydroxyethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 17351299 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | ethyl (E)-4-[[2-(2-hydroxyethylcarbamoyl)phenyl]carbamothioylamino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NC(=S)Nc1ccccc1C(=O)NCCO |
| InChI | InChI=1S/C16H19N3O5S/c1-2-24-14(22)8-7-13(21)19-16(25)18-12-6-4-3-5-11(12)15(23)17-9-10-20/h3-8,20H,2,9-10H2,1H3,(H,17,23)(H2,18,19,21,25)/b8-7+ |
| InChIKey | NJAPRBSOQLHKLJ-BQYQJAHWSA-N |
| XLogP | 0.34 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|