C14H22N2O2 — CID 55047330
2-(ethylamino)-N-(4-methoxybutyl)benzamide (PubChem CID 55047330) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(ethylamino)-N-(4-methoxybutyl)benzamide.
| Compound Name | 2-(ethylamino)-N-(4-methoxybutyl)benzamide |
|---|---|
| PubChem CID | 55047330 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-(ethylamino)-N-(4-methoxybutyl)benzamide |
| SMILES | CCNc1ccccc1C(=O)NCCCCOC |
| InChI | InChI=1S/C14H22N2O2/c1-3-15-13-9-5-4-8-12(13)14(17)16-10-6-7-11-18-2/h4-5,8-9,15H,3,6-7,10-11H2,1-2H3,(H,16,17) |
| InChIKey | VBKXUJAAGZYIGI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|