C17H20N2O4S2 — CID 51182401
methyl 4,5-dimethyl-2-[4-(thiophene-2-carbonylamino)butanoylamino]thiophene-3-carboxylate (PubChem CID 51182401) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is methyl 4,5-dimethyl-2-[4-(thiophene-2-carbonylamino)butanoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4,5-dimethyl-2-[4-(thiophene-2-carbonylamino)butanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 51182401 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | methyl 4,5-dimethyl-2-[4-(thiophene-2-carbonylamino)butanoylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCNC(=O)c2cccs2)sc(C)c1C |
| InChI | InChI=1S/C17H20N2O4S2/c1-10-11(2)25-16(14(10)17(22)23-3)19-13(20)7-4-8-18-15(21)12-6-5-9-24-12/h5-6,9H,4,7-8H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | CXWLPMQONCMFPA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|