C16H17N3O5S2 — CID 4644275
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate (PubChem CID 4644275) has the molecular formula C16H17N3O5S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4644275 |
| Molecular Formula | C16H17N3O5S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CC(=O)Nc1sc(C)c(C)c1C(=O)OCC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H17N3O5S2/c1-8-9(2)26-15(17-10(3)20)13(8)16(23)24-7-12(21)18-19-14(22)11-5-4-6-25-11/h4-6H,7H2,1-3H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | SOUOJZFAJQEWGP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|