C18H21NO3S2 — CID 41085962
methyl 4,5-dimethyl-2-(4-phenylsulfanylbutanoylamino)thiophene-3-carboxylate (PubChem CID 41085962) has the molecular formula C18H21NO3S2 and a molecular weight of 363.50 g/mol. Its IUPAC name is methyl 4,5-dimethyl-2-(4-phenylsulfanylbutanoylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4,5-dimethyl-2-(4-phenylsulfanylbutanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 41085962 |
| Molecular Formula | C18H21NO3S2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | methyl 4,5-dimethyl-2-(4-phenylsulfanylbutanoylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCSc2ccccc2)sc(C)c1C |
| InChI | InChI=1S/C18H21NO3S2/c1-12-13(2)24-17(16(12)18(21)22-3)19-15(20)10-7-11-23-14-8-5-4-6-9-14/h4-6,8-9H,7,10-11H2,1-3H3,(H,19,20) |
| InChIKey | FEYWDFRNRJGMST-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|