C15H24N2O3S — CID 61260025
methyl 2-(7-aminoheptanoylamino)-4,5-dimethylthiophene-3-carboxylate (PubChem CID 61260025) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is methyl 2-(7-aminoheptanoylamino)-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | methyl 2-(7-aminoheptanoylamino)-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 61260025 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | methyl 2-(7-aminoheptanoylamino)-4,5-dimethylthiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)CCCCCCN)sc(C)c1C |
| InChI | InChI=1S/C15H24N2O3S/c1-10-11(2)21-14(13(10)15(19)20-3)17-12(18)8-6-4-5-7-9-16/h4-9,16H2,1-3H3,(H,17,18) |
| InChIKey | KSAXBTRKVYFZOF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|