C16H25NO3S — CID 4688162
ethyl 2-(heptanoylamino)-4,5-dimethylthiophene-3-carboxylate (PubChem CID 4688162) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is ethyl 2-(heptanoylamino)-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(heptanoylamino)-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4688162 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | ethyl 2-(heptanoylamino)-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCCCCCC(=O)Nc1sc(C)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C16H25NO3S/c1-5-7-8-9-10-13(18)17-15-14(16(19)20-6-2)11(3)12(4)21-15/h5-10H2,1-4H3,(H,17,18) |
| InChIKey | MPFMPKHXNQHRHU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|