C11H16Cl3N3OS — CID 3788652
N-[2,2,2-trichloro-1-[2-(dimethylamino)ethylamino]ethyl]thiophene-2-carboxamide (PubChem CID 3788652) has the molecular formula C11H16Cl3N3OS and a molecular weight of 344.70 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[2-(dimethylamino)ethylamino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-[2-(dimethylamino)ethylamino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3788652 |
| Molecular Formula | C11H16Cl3N3OS |
| Molecular Weight | 344.70 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | N-[2,2,2-trichloro-1-[2-(dimethylamino)ethylamino]ethyl]thiophene-2-carboxamide |
| SMILES | CN(C)CCNC(NC(=O)c1cccs1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3N3OS/c1-17(2)6-5-15-10(11(12,13)14)16-9(18)8-4-3-7-19-8/h3-4,7,10,15H,5-6H2,1-2H3,(H,16,18) |
| InChIKey | DSHHVDQRXVARIA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.70 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|