C14H11Cl3IN3OS2 — CID 18839573
N-[2,2,2-trichloro-1-[(4-iodophenyl)carbamothioylamino]ethyl]thiophene-2-carboxamide (PubChem CID 18839573) has the molecular formula C14H11Cl3IN3OS2 and a molecular weight of 534.66 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[(4-iodophenyl)carbamothioylamino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-[(4-iodophenyl)carbamothioylamino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18839573 |
| Molecular Formula | C14H11Cl3IN3OS2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 532.85 |
| IUPAC Name | N-[2,2,2-trichloro-1-[(4-iodophenyl)carbamothioylamino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(NC(=S)Nc1ccc(I)cc1)C(Cl)(Cl)Cl)c1cccs1 |
| InChI | InChI=1S/C14H11Cl3IN3OS2/c15-14(16,17)12(20-11(22)10-2-1-7-24-10)21-13(23)19-9-5-3-8(18)4-6-9/h1-7,12H,(H,20,22)(H2,19,21,23) |
| InChIKey | VTPVLHXRZXTVFK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|