C14H18Cl3N3O — CID 11909249
N-[(1S)-1-[(1-amino-2-methylpropylidene)amino]-2,2,2-trichloroethyl]-4-methylbenzamide (PubChem CID 11909249) has the molecular formula C14H18Cl3N3O and a molecular weight of 350.68 g/mol. Its IUPAC name is N-[(1S)-1-[(1-amino-2-methylpropylidene)amino]-2,2,2-trichloroethyl]-4-methylbenzamide.
| Compound Name | N-[(1S)-1-[(1-amino-2-methylpropylidene)amino]-2,2,2-trichloroethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11909249 |
| Molecular Formula | C14H18Cl3N3O |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[(1S)-1-[(1-amino-2-methylpropylidene)amino]-2,2,2-trichloroethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@@H](N=C(N)C(C)C)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C14H18Cl3N3O/c1-8(2)11(18)19-13(14(15,16)17)20-12(21)10-6-4-9(3)5-7-10/h4-8,13H,1-3H3,(H2,18,19)(H,20,21)/t13-/m1/s1 |
| InChIKey | GLQNVUTUMDVGCV-CYBMUJFWSA-N |
| XLogP | 3.43 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|