C12H14Cl3N3OS — CID 2830390
methyl N-[1-(carbamothioylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate (PubChem CID 2830390) has the molecular formula C12H14Cl3N3OS and a molecular weight of 354.69 g/mol. Its IUPAC name is methyl N-[1-(carbamothioylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate.
| Compound Name | methyl N-[1-(carbamothioylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate |
|---|---|
| PubChem CID | 2830390 |
| Molecular Formula | C12H14Cl3N3OS |
| Molecular Weight | 354.69 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | methyl N-[1-(carbamothioylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate |
| SMILES | COC(=NC(NC(N)=S)C(Cl)(Cl)Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H14Cl3N3OS/c1-7-3-5-8(6-4-7)9(19-2)17-10(12(13,14)15)18-11(16)20/h3-6,10H,1-2H3,(H3,16,18,20) |
| InChIKey | TYEHXYOJLURBQD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.69 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|