C18H17Cl4N3OS — CID 2252635
methyl 4-methyl-N-[(1S)-2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]benzenecarboximidate (PubChem CID 2252635) has the molecular formula C18H17Cl4N3OS and a molecular weight of 465.23 g/mol. Its IUPAC name is methyl 4-methyl-N-[(1S)-2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]benzenecarboximidate.
| Compound Name | methyl 4-methyl-N-[(1S)-2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]benzenecarboximidate |
|---|---|
| PubChem CID | 2252635 |
| Molecular Formula | C18H17Cl4N3OS |
| Molecular Weight | 465.23 g/mol |
| Exact Mass | 462.98 |
| IUPAC Name | methyl 4-methyl-N-[(1S)-2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]benzenecarboximidate |
| SMILES | COC(=N[C@H](NC(=S)Nc1ccc(Cl)cc1)C(Cl)(Cl)Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H17Cl4N3OS/c1-11-3-5-12(6-4-11)15(26-2)24-16(18(20,21)22)25-17(27)23-14-9-7-13(19)8-10-14/h3-10,16H,1-2H3,(H2,23,25,27)/t16-/m1/s1 |
| InChIKey | FXQGTCHGQJFMJA-MRXNPFEDSA-N |
| XLogP | 5.72 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.23 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|