C18H17BrCl3N3OS — CID 6611972
methyl N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate (PubChem CID 6611972) has the molecular formula C18H17BrCl3N3OS and a molecular weight of 509.68 g/mol. Its IUPAC name is methyl N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate.
| Compound Name | methyl N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate |
|---|---|
| PubChem CID | 6611972 |
| Molecular Formula | C18H17BrCl3N3OS |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 506.93 |
| IUPAC Name | methyl N-[1-[(4-bromophenyl)carbamothioylamino]-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate |
| SMILES | COC(=NC(NC(=S)Nc1ccc(Br)cc1)C(Cl)(Cl)Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H17BrCl3N3OS/c1-11-3-5-12(6-4-11)15(26-2)24-16(18(20,21)22)25-17(27)23-14-9-7-13(19)8-10-14/h3-10,16H,1-2H3,(H2,23,25,27) |
| InChIKey | VKEYTVNFIYNOCU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|