C16H22Cl3N3OS — CID 3387098
methyl N-[1-(tert-butylcarbamothioylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate (PubChem CID 3387098) has the molecular formula C16H22Cl3N3OS and a molecular weight of 410.80 g/mol. Its IUPAC name is methyl N-[1-(tert-butylcarbamothioylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate.
| Compound Name | methyl N-[1-(tert-butylcarbamothioylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate |
|---|---|
| PubChem CID | 3387098 |
| Molecular Formula | C16H22Cl3N3OS |
| Molecular Weight | 410.80 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | methyl N-[1-(tert-butylcarbamothioylamino)-2,2,2-trichloroethyl]-4-methylbenzenecarboximidate |
| SMILES | COC(=NC(NC(=S)NC(C)(C)C)C(Cl)(Cl)Cl)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22Cl3N3OS/c1-10-6-8-11(9-7-10)12(23-5)20-13(16(17,18)19)21-14(24)22-15(2,3)4/h6-9,13H,1-5H3,(H2,21,22,24) |
| InChIKey | RUTDVTZVUCXSFQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|