C14H13Cl3N2O — CID 2315863
N-[(1S)-2,2,2-trichloro-1-(1-methylpyrrol-2-yl)ethyl]benzamide (PubChem CID 2315863) has the molecular formula C14H13Cl3N2O and a molecular weight of 331.63 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(1-methylpyrrol-2-yl)ethyl]benzamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(1-methylpyrrol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2315863 |
| Molecular Formula | C14H13Cl3N2O |
| Molecular Weight | 331.63 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(1-methylpyrrol-2-yl)ethyl]benzamide |
| SMILES | Cn1cccc1[C@H](NC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H13Cl3N2O/c1-19-9-5-8-11(19)12(14(15,16)17)18-13(20)10-6-3-2-4-7-10/h2-9,12H,1H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | YFZLEIOJJYDKRI-LBPRGKRZSA-N |
| XLogP | 3.87 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|