C20H17F3N2O — CID 101433345
N-[(1-methylpyrrol-2-yl)-[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 101433345) has the molecular formula C20H17F3N2O and a molecular weight of 358.36 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)-[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | N-[(1-methylpyrrol-2-yl)-[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 101433345 |
| Molecular Formula | C20H17F3N2O |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)-[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | Cn1cccc1C(NC(=O)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17F3N2O/c1-25-13-5-8-17(25)18(24-19(26)15-6-3-2-4-7-15)14-9-11-16(12-10-14)20(21,22)23/h2-13,18H,1H3,(H,24,26) |
| InChIKey | OQKKZNBPJGCEMD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |