C18H22Cl2F3NO — CID 159820539
1-phenyl-1-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-ol;dihydrochloride (PubChem CID 159820539) has the molecular formula C18H22Cl2F3NO and a molecular weight of 396.28 g/mol. Its IUPAC name is 1-phenyl-1-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-ol;dihydrochloride.
| Compound Name | 1-phenyl-1-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 159820539 |
| Molecular Formula | C18H22Cl2F3NO |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-phenyl-1-[[3-(trifluoromethyl)phenyl]methylamino]butan-2-ol;dihydrochloride |
| SMILES | CCC(O)C(NCc1cccc(C(F)(F)F)c1)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C18H20F3NO.2ClH/c1-2-16(23)17(14-8-4-3-5-9-14)22-12-13-7-6-10-15(11-13)18(19,20)21;;/h3-11,16-17,22-23H,2,12H2,1H3;2*1H |
| InChIKey | IAKQLCKNBOQDMF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |