C17H18F2INO — CID 142241998
1-(3,5-difluorophenyl)-1-[(3-iodophenyl)methylamino]butan-2-ol (PubChem CID 142241998) has the molecular formula C17H18F2INO and a molecular weight of 417.24 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-1-[(3-iodophenyl)methylamino]butan-2-ol.
| Compound Name | 1-(3,5-difluorophenyl)-1-[(3-iodophenyl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 142241998 |
| Molecular Formula | C17H18F2INO |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 1-(3,5-difluorophenyl)-1-[(3-iodophenyl)methylamino]butan-2-ol |
| SMILES | CCC(O)C(NCc1cccc(I)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H18F2INO/c1-2-16(22)17(12-7-13(18)9-14(19)8-12)21-10-11-4-3-5-15(20)6-11/h3-9,16-17,21-22H,2,10H2,1H3 |
| InChIKey | AUPWBZLXHGEDJY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|