About 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol
2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol (PubChem CID 141141855) has the molecular formula C20H16F2INO
and a molecular weight of 451.25 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol.
Molecular Properties
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol |
| PubChem CID | 141141855 |
| Molecular Formula | C20H16F2INO |
| Molecular Weight | 451.25 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol |
| SMILES | Oc1c(Cc2cc(F)cc(F)c2)cccc1NCc1cccc(I)c1 |
| InChI | InChI=1S/C20H16F2INO/c21-16-8-14(9-17(22)11-16)7-15-4-2-6-19(20(15)25)24-12-13-3-1-5-18(23)10-13/h1-6,8-11,24-25H,7,12H2 |
| InChIKey | SRUJBHZDTVQILF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.25 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol?
The IUPAC name of 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol (CID 141141855) is 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol.
What is the SMILES notation for 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol?
The canonical SMILES for 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol is Oc1c(Cc2cc(F)cc(F)c2)cccc1NCc1cccc(I)c1.
What is the InChIKey of 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol?
The InChIKey is SRUJBHZDTVQILF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2INO/c21-16-8-14(9-17(22)11-16)7-15-4-2-6-19(20(15)25)24-12-13-3-1-5-18(23)10-13/h1-6,8-11,24-25H,7,12H2.
What are the key properties of 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol?
2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol has a molecular weight of 451.25 g/mol, XLogP of 5.48, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol is sourced from PubChem (CID 141141855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).