C20H16F2INO — CID 141141855
2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol (PubChem CID 141141855) has the molecular formula C20H16F2INO and a molecular weight of 451.25 g/mol. Its IUPAC name is 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol.
| Compound Name | 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol |
|---|---|
| PubChem CID | 141141855 |
| Molecular Formula | C20H16F2INO |
| Molecular Weight | 451.25 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 2-[(3,5-difluorophenyl)methyl]-6-[(3-iodophenyl)methylamino]phenol |
| SMILES | Oc1c(Cc2cc(F)cc(F)c2)cccc1NCc1cccc(I)c1 |
| InChI | InChI=1S/C20H16F2INO/c21-16-8-14(9-17(22)11-16)7-15-4-2-6-19(20(15)25)24-12-13-3-1-5-18(23)10-13/h1-6,8-11,24-25H,7,12H2 |
| InChIKey | SRUJBHZDTVQILF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.25 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|