C14H12F3NO — CID 112606802
2-methyl-6-[(2,3,5-trifluoroanilino)methyl]phenol (PubChem CID 112606802) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is 2-methyl-6-[(2,3,5-trifluoroanilino)methyl]phenol.
| Compound Name | 2-methyl-6-[(2,3,5-trifluoroanilino)methyl]phenol |
|---|---|
| PubChem CID | 112606802 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-methyl-6-[(2,3,5-trifluoroanilino)methyl]phenol |
| SMILES | Cc1cccc(CNc2cc(F)cc(F)c2F)c1O |
| InChI | InChI=1S/C14H12F3NO/c1-8-3-2-4-9(14(8)19)7-18-12-6-10(15)5-11(16)13(12)17/h2-6,18-19H,7H2,1H3 |
| InChIKey | NMWGFUYZVIQDFE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|