C17H12F3N — CID 63476657
2,3,5-trifluoro-N-(naphthalen-1-ylmethyl)aniline (PubChem CID 63476657) has the molecular formula C17H12F3N and a molecular weight of 287.28 g/mol. Its IUPAC name is 2,3,5-trifluoro-N-(naphthalen-1-ylmethyl)aniline.
| Compound Name | 2,3,5-trifluoro-N-(naphthalen-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 63476657 |
| Molecular Formula | C17H12F3N |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2,3,5-trifluoro-N-(naphthalen-1-ylmethyl)aniline |
| SMILES | Fc1cc(F)c(F)c(NCc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C17H12F3N/c18-13-8-15(19)17(20)16(9-13)21-10-12-6-3-5-11-4-1-2-7-14(11)12/h1-9,21H,10H2 |
| InChIKey | AYGHFFATXJWHAA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|