C13H17F3IN — CID 114009985
1-iodo-3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]butan-2-amine (PubChem CID 114009985) has the molecular formula C13H17F3IN and a molecular weight of 371.18 g/mol. Its IUPAC name is 1-iodo-3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]butan-2-amine.
| Compound Name | 1-iodo-3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 114009985 |
| Molecular Formula | C13H17F3IN |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 1-iodo-3-methyl-N-[[3-(trifluoromethyl)phenyl]methyl]butan-2-amine |
| SMILES | CC(C)C(CI)NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3IN/c1-9(2)12(7-17)18-8-10-4-3-5-11(6-10)13(14,15)16/h3-6,9,12,18H,7-8H2,1-2H3 |
| InChIKey | YWMTXJGYDSADQU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|