C12H17F2N — CID 116992438
N-[[3-(1,1-difluoroethyl)phenyl]methyl]propan-2-amine (PubChem CID 116992438) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is N-[[3-(1,1-difluoroethyl)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[3-(1,1-difluoroethyl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 116992438 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[[3-(1,1-difluoroethyl)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cccc(C(C)(F)F)c1 |
| InChI | InChI=1S/C12H17F2N/c1-9(2)15-8-10-5-4-6-11(7-10)12(3,13)14/h4-7,9,15H,8H2,1-3H3 |
| InChIKey | UTJJPVLDTQTDCB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |