C9H9NOS2 — CID 67759146
1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethanol (PubChem CID 67759146) has the molecular formula C9H9NOS2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethanol.
| Compound Name | 1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 67759146 |
| Molecular Formula | C9H9NOS2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethanol |
| SMILES | OC(Cc1ccsc1)c1nccs1 |
| InChI | InChI=1S/C9H9NOS2/c11-8(9-10-2-4-13-9)5-7-1-3-12-6-7/h1-4,6,8,11H,5H2 |
| InChIKey | FFKNDJAJDJLYFQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |