C16H18N4O3S2 — CID 110221820
1,3-dimethyl-5-[[[1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethyl]amino]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 110221820) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[[1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethyl]amino]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[[[1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethyl]amino]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 110221820 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 1,3-dimethyl-5-[[[1-(1,3-thiazol-2-yl)-2-thiophen-3-ylethyl]amino]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(CNC(Cc2ccsc2)c2nccs2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C16H18N4O3S2/c1-19-14(21)11(15(22)20(2)16(19)23)8-18-12(13-17-4-6-25-13)7-10-3-5-24-9-10/h3-6,9,11-12,18H,7-8H2,1-2H3 |
| InChIKey | LAAKCRLMZTWDKD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|