C6H6N2OS — CID 119082530
3-hydroxy-3-(1,3-thiazol-2-yl)propanenitrile (PubChem CID 119082530) has the molecular formula C6H6N2OS and a molecular weight of 154.19 g/mol. Its IUPAC name is 3-hydroxy-3-(1,3-thiazol-2-yl)propanenitrile.
| Compound Name | 3-hydroxy-3-(1,3-thiazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 119082530 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 3-hydroxy-3-(1,3-thiazol-2-yl)propanenitrile |
| SMILES | N#CCC(O)c1nccs1 |
| InChI | InChI=1S/C6H6N2OS/c7-2-1-5(9)6-8-3-4-10-6/h3-5,9H,1H2 |
| InChIKey | BVOPQJIAGJLRSZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |