C5H5N3S — CID 22329416
2-amino-2-(1,3-thiazol-2-yl)acetonitrile (PubChem CID 22329416) has the molecular formula C5H5N3S and a molecular weight of 139.18 g/mol. Its IUPAC name is 2-amino-2-(1,3-thiazol-2-yl)acetonitrile.
| Compound Name | 2-amino-2-(1,3-thiazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 22329416 |
| Molecular Formula | C5H5N3S |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | 2-amino-2-(1,3-thiazol-2-yl)acetonitrile |
| SMILES | N#CC(N)c1nccs1 |
| InChI | InChI=1S/C5H5N3S/c6-3-4(7)5-8-1-2-9-5/h1-2,4H,7H2 |
| InChIKey | AMBSMQQXYCRUSJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |