C13H13NO3S — CID 54127958
4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid (PubChem CID 54127958) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid.
| Compound Name | 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 54127958 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid |
| SMILES | O=C(O)CC(Cc1ccc(O)cc1)c1nccs1 |
| InChI | InChI=1S/C13H13NO3S/c15-11-3-1-9(2-4-11)7-10(8-12(16)17)13-14-5-6-18-13/h1-6,10,15H,7-8H2,(H,16,17) |
| InChIKey | NSHQJMHMFPMQBD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |