4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid

C13H13NO3S — CID 54127958

IUPAC4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid
SMILESO=C(O)CC(Cc1ccc(O)cc1)c1nccs1
InChIInChI=1S/C13H13NO3S/c15-11-3-1-9(2-4-11)7-10(8-12(16)17)13-14-5-6-18-13/h1-6,10,15H,7-8H2,(H,16,17)
InChIKeyNSHQJMHMFPMQBD-UHFFFAOYSA-N
MW263.32 g/mol
LogP2.65
Rot. Bonds5

About 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid

4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid (PubChem CID 54127958) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid
PubChem CID54127958
Molecular FormulaC13H13NO3S
Molecular Weight263.32 g/mol
Exact Mass263.06
IUPAC Name4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid
SMILESO=C(O)CC(Cc1ccc(O)cc1)c1nccs1
InChIInChI=1S/C13H13NO3S/c15-11-3-1-9(2-4-11)7-10(8-12(16)17)13-14-5-6-18-13/h1-6,10,15H,7-8H2,(H,16,17)
InChIKeyNSHQJMHMFPMQBD-UHFFFAOYSA-N
XLogP2.65
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.32
LogP ≤ 52.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid?
The IUPAC name of 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid (CID 54127958) is 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid.
What is the SMILES notation for 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid?
The canonical SMILES for 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid is O=C(O)CC(Cc1ccc(O)cc1)c1nccs1.
What is the InChIKey of 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid?
The InChIKey is NSHQJMHMFPMQBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c15-11-3-1-9(2-4-11)7-10(8-12(16)17)13-14-5-6-18-13/h1-6,10,15H,7-8H2,(H,16,17).
What are the key properties of 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid?
4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid has a molecular weight of 263.32 g/mol, XLogP of 2.65, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxyphenyl)-3-(1,3-thiazol-2-yl)butanoic acid is sourced from PubChem (CID 54127958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).