C11H12N2OS — CID 115032136
4-[2-amino-1-(1,3-thiazol-2-yl)ethyl]phenol (PubChem CID 115032136) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 4-[2-amino-1-(1,3-thiazol-2-yl)ethyl]phenol.
| Compound Name | 4-[2-amino-1-(1,3-thiazol-2-yl)ethyl]phenol |
|---|---|
| PubChem CID | 115032136 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 4-[2-amino-1-(1,3-thiazol-2-yl)ethyl]phenol |
| SMILES | NCC(c1ccc(O)cc1)c1nccs1 |
| InChI | InChI=1S/C11H12N2OS/c12-7-10(11-13-5-6-15-11)8-1-3-9(14)4-2-8/h1-6,10,14H,7,12H2 |
| InChIKey | ASQSGDVTMBYHIR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |