C10H10N2OS — CID 115024716
3-[amino(1,3-thiazol-2-yl)methyl]phenol (PubChem CID 115024716) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-[amino(1,3-thiazol-2-yl)methyl]phenol.
| Compound Name | 3-[amino(1,3-thiazol-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 115024716 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3-[amino(1,3-thiazol-2-yl)methyl]phenol |
| SMILES | NC(c1cccc(O)c1)c1nccs1 |
| InChI | InChI=1S/C10H10N2OS/c11-9(10-12-4-5-14-10)7-2-1-3-8(13)6-7/h1-6,9,13H,11H2 |
| InChIKey | KJKSERMHJRHSBJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |