C10H7F3N2S — CID 63077873
1,3-thiazol-2-yl-(3,4,5-trifluorophenyl)methanamine (PubChem CID 63077873) has the molecular formula C10H7F3N2S and a molecular weight of 244.24 g/mol. Its IUPAC name is 1,3-thiazol-2-yl-(3,4,5-trifluorophenyl)methanamine.
| Compound Name | 1,3-thiazol-2-yl-(3,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 63077873 |
| Molecular Formula | C10H7F3N2S |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 1,3-thiazol-2-yl-(3,4,5-trifluorophenyl)methanamine |
| SMILES | NC(c1cc(F)c(F)c(F)c1)c1nccs1 |
| InChI | InChI=1S/C10H7F3N2S/c11-6-3-5(4-7(12)8(6)13)9(14)10-15-1-2-16-10/h1-4,9H,14H2 |
| InChIKey | OUMLTAYPSARTSW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|