C8H7BrN2S2 — CID 61347211
(5-bromothiophen-2-yl)-(1,3-thiazol-2-yl)methanamine (PubChem CID 61347211) has the molecular formula C8H7BrN2S2 and a molecular weight of 275.20 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-(1,3-thiazol-2-yl)methanamine.
| Compound Name | (5-bromothiophen-2-yl)-(1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 61347211 |
| Molecular Formula | C8H7BrN2S2 |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 273.92 |
| IUPAC Name | (5-bromothiophen-2-yl)-(1,3-thiazol-2-yl)methanamine |
| SMILES | NC(c1ccc(Br)s1)c1nccs1 |
| InChI | InChI=1S/C8H7BrN2S2/c9-6-2-1-5(13-6)7(10)8-11-3-4-12-8/h1-4,7H,10H2 |
| InChIKey | BSVGTBZBHONZFB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |