C11H11ClN2S — CID 106818042
(3-chloro-4-methylphenyl)-(1,3-thiazol-2-yl)methanamine (PubChem CID 106818042) has the molecular formula C11H11ClN2S and a molecular weight of 238.74 g/mol. Its IUPAC name is (3-chloro-4-methylphenyl)-(1,3-thiazol-2-yl)methanamine.
| Compound Name | (3-chloro-4-methylphenyl)-(1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 106818042 |
| Molecular Formula | C11H11ClN2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (3-chloro-4-methylphenyl)-(1,3-thiazol-2-yl)methanamine |
| SMILES | Cc1ccc(C(N)c2nccs2)cc1Cl |
| InChI | InChI=1S/C11H11ClN2S/c1-7-2-3-8(6-9(7)12)10(13)11-14-4-5-15-11/h2-6,10H,13H2,1H3 |
| InChIKey | VNVYVMAJCCCANJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |